ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
|
उत्पाद का नाम | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
अंग्रेज | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde;1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-;NSC 68230;2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde;Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI);1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde;2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
आणविक फार्मूला | C13H19NO |
आण्विक वजन | 205.2961 |
InChI | InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
कैस रजिस्टी संख्या | 83-18-1 |
EINECS | 201-458-6 |
आणविक संरचना | |
घनत्व | 1.07g/cm3 |
उबलने का समय | 345.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.559 |
फ्लैश प्वाइंट | 163°C |
वाष्प का दबाव | 6E-05mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |