ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Thianaphthene-1,1-dioxide |
|
उत्पाद का नाम | Thianaphthene-1,1-dioxide |
अंग्रेज | Thianaphthene-1,1-dioxide;Thianaphthene 1,1-dioxide;Benzo[b]thiophene 1,1-dioxide;1-benzothiophene 1,1-dioxide |
आणविक फार्मूला | C8H6O2S |
आण्विक वजन | 166.197 |
InChI | InChI=1/C8H6O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-6H |
कैस रजिस्टी संख्या | 825-44-5 |
EINECS | 212-544-8 |
आणविक संरचना | |
घनत्व | 1.403g/cm3 |
गलनांक | 137-138℃ |
उबलने का समय | 371.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.64 |
फ्लैश प्वाइंट | 244°C |
वाष्प का दबाव | 2.25E-05mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |