ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
824-55-5 1-(chloromethyl)-2,4-dimethylbenzene |
|
उत्पाद का नाम | 1-(chloromethyl)-2,4-dimethylbenzene |
अंग्रेज | 1-(chloromethyl)-2,4-dimethylbenzene;2,4-Dimethylbenzyl chloride;4-(Chloromethyl)-m-xylene;2,4-Dimethylbenzylchloride |
आणविक फार्मूला | C9H11Cl |
आण्विक वजन | 154.6366 |
InChI | InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
कैस रजिस्टी संख्या | 824-55-5 |
EINECS | 212-531-7 |
आणविक संरचना | ![]() |
घनत्व | 1.033g/cm3 |
उबलने का समय | 215.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.522 |
फ्लैश प्वाइंट | 86.5°C |
वाष्प का दबाव | 0.216mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R34##Causes burns.||R36##Irritating to eyes.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |