ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
823-76-7 Cyclohexyl methyl ketone |
|
उत्पाद का नाम | Cyclohexyl methyl ketone |
अंग्रेज | Cyclohexyl methyl ketone;Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone;Acetylcyclohexane;1-cyclohexylethanone;1-CYCLOHEXYLETHAN-1-ONE |
आणविक फार्मूला | C8H14O |
आण्विक वजन | 126.1962 |
InChI | InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
कैस रजिस्टी संख्या | 823-76-7 |
EINECS | 212-517-0 |
आणविक संरचना | |
घनत्व | 0.916g/cm3 |
उबलने का समय | 181.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.448 |
फ्लैश प्वाइंट | 61.4°C |
वाष्प का दबाव | 0.849mmHg at 25°C |
खतरे के कोड | R36/38##Irritating to eyes and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |