ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,1'-डायथ्रिमाइड |
|
उत्पाद का नाम | 1,1'-डायथ्रिमाइड |
समानार्थी | ; 1,1-इमिनोडिएन्थ्राक्विनोन; 1,1'-इमिनोडिएन्थ्रेसिन-9,10-डायोन; |
अंग्रेज | 1,1'-dianthrimide;1,1-iminodianthraquinone;1,1'-iminodianthracene-9,10-dione |
आणविक फार्मूला | C28H15NO4 |
आण्विक वजन | 429.423 |
InChI | InChI=1/C28H15NO4/c30-25-15-7-1-3-9-17(15)27(32)23-19(25)11-5-13-21(23)29-22-14-6-12-20-24(22)28(33)18-10-4-2-8-16(18)26(20)31/h1-14,29H |
कैस रजिस्टी संख्या | 82-22-4 |
EINECS | 201-405-7 |
आणविक संरचना | |
घनत्व | 1.456g/cm3 |
गलनांक | 300℃ |
उबलने का समय | 667.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.753 |
फ्लैश प्वाइंट | 221.6°C |
वाष्प का दबाव | 1.17E-17mmHg at 25°C |
खतरा प्रतीक | Xi##Irritant:; |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |