ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
814-68-6 Acryloyl chloride |
|
उत्पाद का नाम | Acryloyl chloride |
अंग्रेज | Acryloyl chloride;Propenoyl chloride;Acrylyl chloride;prop-2-enoyl chloride;Acyloyl chloride |
आणविक फार्मूला | C3H3OCl |
आण्विक वजन | 90.5083 |
InChI | InChI=1/C3H3ClO/c1-2-3(4)5/h2H,1H2 |
कैस रजिस्टी संख्या | 814-68-6 |
EINECS | 212-399-0 |
आणविक संरचना | ![]() |
घनत्व | 1.108g/cm3 |
उबलने का समय | 75.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.417 |
फ्लैश प्वाइंट | 16.1°C |
वाष्प का दबाव | 105mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R11##Highly flammable.||R34##Causes burns.:; |
सुरक्षा विवरण | S16##Keep away from sources of ignition - No smoking.||S30##Never add water to this product.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |