ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
780-05-2 N-(4-fluorophenyl)maleamic acid |
|
उत्पाद का नाम | N-(4-fluorophenyl)maleamic acid |
अंग्रेज | N-(4-fluorophenyl)maleamic acid;Maleic acid mono(4-fluorophenyl)amide;(2Z)-4-[(4-fluorophenyl)amino]-4-oxobut-2-enoic acid |
आणविक फार्मूला | C10H8FNO3 |
आण्विक वजन | 209.1738 |
InChI | InChI=1/C10H8FNO3/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(14)15/h1-6H,(H,12,13)(H,14,15)/b6-5- |
कैस रजिस्टी संख्या | 780-05-2 |
आणविक संरचना | |
घनत्व | 1.413g/cm3 |
गलनांक | 207-209℃ |
उबलने का समय | 437.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.611 |
फ्लैश प्वाइंट | 218.2°C |
वाष्प का दबाव | 2.03E-08mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |