ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Dicyclopentadiene |
|
उत्पाद का नाम | Dicyclopentadiene |
अंग्रेज | Dicyclopentadiene;3a,4,7,7a-Tetrahydro-4,7-methanoindene;Cyclopentadiene dimer~3a,4,7,7a-Tetrahydro-4,7-methanoindene;DCPD;dicyclopentadiene (stabilized with bht);Dicyclopentadiene (>95%);Dicyclopentadiene (70%);Dicyopentadiene;Dicyclopentadiene (80%);Dicyclopentadiene dimer |
आणविक फार्मूला | C10H12 |
आण्विक वजन | 132.2 |
InChI | InChI=1/C10H12/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,4-5,7-10H,3,6H2 |
कैस रजिस्टी संख्या | 77-73-6 |
EINECS | 201-052-9 |
आणविक संरचना | |
घनत्व | 0.982 |
गलनांक | -1℃ |
उबलने का समय | 170℃ |
अपवर्तक सूचकांक | 1.51-1.512 |
फ्लैश प्वाइंट | 26℃ |
खतरा प्रतीक | F##Flammable||Xn##Harmful||N##Dangerous for the environment:; |
खतरे के कोड | R11||R20/22||R36/37/38||R51/53:; |
सुरक्षा विवरण | S36/37||S61:; |
MSDS |