ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-62-3 Methylenebismethylcyclohexylpcresol; 90% |
|
उत्पाद का नाम | Methylenebismethylcyclohexylpcresol; 90% |
अंग्रेज | Methylenebismethylcyclohexylpcresol; 90%;Bis[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methane;2,2-methylenebis(6-cyclohexyl-4-methylphenol);2,2-Methylenebis[6-(1-methylcyclohexyl)-p-cresol];2,2'-methanediylbis[4-methyl-6-(1-methylcyclohexyl)phenol] |
आणविक फार्मूला | C29H40O2 |
आण्विक वजन | 420.6267 |
InChI | InChI=1/C29H40O2/c1-20-15-22(26(30)24(17-20)28(3)11-7-5-8-12-28)19-23-16-21(2)18-25(27(23)31)29(4)13-9-6-10-14-29/h15-18,30-31H,5-14,19H2,1-4H3 |
कैस रजिस्टी संख्या | 77-62-3 |
EINECS | 201-044-5 |
आणविक संरचना | ![]() |
घनत्व | 1.058g/cm3 |
उबलने का समय | 526.9°C at 760 mmHg |
अपवर्तक सूचकांक | 1.567 |
फ्लैश प्वाइंट | 219.2°C |
वाष्प का दबाव | 1.02E-11mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |