ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-61-2 2,4-डाइमिथाइल-6- (1-मिथाइलसाइक्लोहेक्सिल) फिनोल |
|
उत्पाद का नाम | 2,4-डाइमिथाइल-6- (1-मिथाइलसाइक्लोहेक्सिल) फिनोल |
समानार्थी | ; लोविनॉक्स (आरजी डब्ल्यूएसएल; 6- (1-मिथाइलसाइक्लोहेक्सिल) -2,4-ज़ाइलेनॉल; |
अंग्रेज | 2,4-Dimethyl-6-(1-methylcyclohexyl)phenol;Lowinox(rg WSL;6-(1-Methylcyclohexyl)-2,4-xylenol |
आणविक फार्मूला | C15H22O |
आण्विक वजन | 218.3346 |
InChI | InChI=1/C15H22O/c1-11-9-12(2)14(16)13(10-11)15(3)7-5-4-6-8-15/h9-10,16H,4-8H2,1-3H3 |
कैस रजिस्टी संख्या | 77-61-2 |
EINECS | 201-042-4 |
आणविक संरचना | |
घनत्व | 0.992g/cm3 |
उबलने का समय | 311°C at 760 mmHg |
अपवर्तक सूचकांक | 1.532 |
फ्लैश प्वाइंट | 140°C |
वाष्प का दबाव | 0.000317mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.||R43##May cause sensitization by skin contact.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |