ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-04-3 Pyrithyldione |
|
उत्पाद का नाम | Pyrithyldione |
अंग्रेज | Pyrithyldione;3,3-Diethyl-2,4(1H,3H)-pyridinedione;3,3-diethylpyridine-2,4(1H,3H)-dione |
आणविक फार्मूला | C9H13NO2 |
आण्विक वजन | 167.205 |
InChI | InChI=1/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
कैस रजिस्टी संख्या | 77-04-3 |
EINECS | 201-000-5 |
आणविक संरचना | |
घनत्व | 1.029g/cm3 |
उबलने का समय | 330.2°C at 760 mmHg |
अपवर्तक सूचकांक | 1.464 |
फ्लैश प्वाइंट | 147.8°C |
वाष्प का दबाव | 0.000169mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R20/21##Harmful by inhalation and in contact with skin.:; |
सुरक्षा विवरण | S23##Do not inhale gas/fumes/vapour/spray.:; |
MSDS |