ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Bromodichloromethane |
|
उत्पाद का नाम | Bromodichloromethane |
अंग्रेज | Bromodichloromethane;FC-20B1 |
आणविक फार्मूला | CHBrCl2 |
आण्विक वजन | 163.8286 |
InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
कैस रजिस्टी संख्या | 75-27-4 |
EINECS | 200-856-7 |
आणविक संरचना | |
घनत्व | 2.013g/cm3 |
गलनांक | -55℃ |
उबलने का समय | 89.7°C at 760 mmHg |
अपवर्तक सूचकांक | 1.503 |
फ्लैश प्वाइंट | 1.3°C |
वाष्प का दबाव | 65.3mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
सुरक्षा विवरण | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |