ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
729-43-1 Acetophenone Azine |
|
उत्पाद का नाम | Acetophenone Azine |
अंग्रेज | Acetophenone Azine;Ethanone, 1-phenyl-, 2-(1-phenylethylidene)hydrazone;Acetophenone azine;Ethanone, 1-phenyl-, (1-phenylethylidene)hydrazone;NSC 25772;1-Phenylethan-1-one (1-phenylethylidene)hydrazone;Acetophenone, azine (8CI);bis(1-phenylethylidene)hydrazine;(1Z,2Z)-bis(1-phenylethylidene)hydrazine;(1E,2E)-bis(1-phenylethylidene)hydrazine |
आणविक फार्मूला | C16H16N2 |
आण्विक वजन | 236.3116 |
InChI | InChI=1/C16H16N2/c1-13(15-9-5-3-6-10-15)17-18-14(2)16-11-7-4-8-12-16/h3-12H,1-2H3/b17-13+,18-14+ |
कैस रजिस्टी संख्या | 729-43-1 |
EINECS | 211-979-0 |
आणविक संरचना | ![]() |
घनत्व | 0.98g/cm3 |
उबलने का समय | 333.2°C at 760 mmHg |
अपवर्तक सूचकांक | 1.551 |
फ्लैश प्वाइंट | 147.4°C |
वाष्प का दबाव | 0.000268mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |