ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72856-73-6 2-methoxy-4-(methylthio)benzoic acid |
|
उत्पाद का नाम | 2-methoxy-4-(methylthio)benzoic acid |
अंग्रेज | 2-methoxy-4-(methylthio)benzoic acid;4-(Methylthio)-o-anisic acid;2-methoxy-4-(methylsulfanyl)benzoic acid |
आणविक फार्मूला | C9H10O3S |
आण्विक वजन | 198.2389 |
InChI | InChI=1/C9H10O3S/c1-12-8-5-6(13-2)3-4-7(8)9(10)11/h3-5H,1-2H3,(H,10,11) |
कैस रजिस्टी संख्या | 72856-73-6 |
EINECS | 276-948-6 |
आणविक संरचना | |
घनत्व | 1.29g/cm3 |
उबलने का समय | 342.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.592 |
फ्लैश प्वाइंट | 160.8°C |
वाष्प का दबाव | 2.92E-05mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |