ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
723-89-7 1-phenylisatin |
|
उत्पाद का नाम | 1-phenylisatin |
अंग्रेज | 1-phenylisatin;1H-Indole-2,3-dione, 1-phenyl- (9CI);1-Phenyl-1H-indole-2,3-dione;1-Phenyl-indole-2,3-dione;1-Phenylisatin;5-21-10-00247 (Beilstein Handbook Reference);BRN 0164531;NSC 100013;Indole-2,3-dione, 1-phenyl- |
आणविक फार्मूला | C14H9NO2 |
आण्विक वजन | 223.2268 |
InChI | InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
कैस रजिस्टी संख्या | 723-89-7 |
आणविक संरचना | ![]() |
घनत्व | 1.338g/cm3 |
गलनांक | 138-140℃ |
उबलने का समय | 388.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.667 |
फ्लैश प्वाइंट | 182.6°C |
वाष्प का दबाव | 2.99E-06mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |