ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
|
उत्पाद का नाम | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
अंग्रेज | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
आणविक फार्मूला | C14H8Cl4 |
आण्विक वजन | 318.02 |
InChI | InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
कैस रजिस्टी संख्या | 72-55-9 |
EINECS | 200-784-6 |
आणविक संरचना | |
गलनांक | 87-90℃ |
पानी की विलेयता | 0.00000013 g/100 mL |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R22##Harmful if swallowed.||R33##Danger of cummulative effects.:; |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |