ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
9-chloroanthracene |
|
उत्पाद का नाम | 9-chloroanthracene |
अंग्रेज | 9-chloroanthracene;Anthracene, 9-chloro-;9-Chloroanthracene;CCRIS 5547 |
आणविक फार्मूला | C14H9Cl |
आण्विक वजन | 212.6743 |
InChI | InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
कैस रजिस्टी संख्या | 716-53-0 |
EINECS | 211-937-1 |
आणविक संरचना | |
घनत्व | 1.253g/cm3 |
गलनांक | 103-103℃ |
उबलने का समय | 370.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.717 |
फ्लैश प्वाइंट | 179.2°C |
वाष्प का दबाव | 2.42E-05mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |