ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Bis(2-thienyl) ketone |
|
उत्पाद का नाम | Bis(2-thienyl) ketone |
अंग्रेज | Bis(2-thienyl) ketone;Di-2-thienyl ketone;Bis(2-thienyl)ketone~Di-2-thienyl ketone;dithiophen-2-ylmethanone |
आणविक फार्मूला | C9H6OS2 |
आण्विक वजन | 194.2733 |
InChI | InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
कैस रजिस्टी संख्या | 704-38-1 |
आणविक संरचना | |
घनत्व | 1.326g/cm3 |
गलनांक | 89-91℃ |
उबलने का समय | 323°C at 760 mmHg |
अपवर्तक सूचकांक | 1.64 |
फ्लैश प्वाइंट | 149.1°C |
वाष्प का दबाव | 0.00027mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |