ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-chloro-4-fluoroacetophenone |
|
उत्पाद का नाम | 2-chloro-4-fluoroacetophenone |
अंग्रेज | 2-chloro-4-fluoroacetophenone;2'-chloro-4'-fluoroacetophenone;1-(2-chloro-4-fluoro-phenyl)ethanone |
आणविक फार्मूला | C8H6ClFO |
आण्विक वजन | 172.584 |
InChI | InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
कैस रजिस्टी संख्या | 700-35-6 |
आणविक संरचना | |
घनत्व | 1.259g/cm3 |
उबलने का समय | 203.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.512 |
फ्लैश प्वाइंट | 76.814°C |
वाष्प का दबाव | 0.278mmHg at 25°C |
खतरे के कोड | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |