ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
693-55-0 Ethyl hydrogen sebacate |
|
उत्पाद का नाम | Ethyl hydrogen sebacate |
अंग्रेज | Ethyl hydrogen sebacate;Monoethyl sebacate~Sebacic acid monoethyl ester;monoethyl sebacate;Decanedioic acid monoethyl ester~Monoethyl sebacate~Sebacic acid monoethyl ester;10-ethoxy-10-oxodecanoic acid |
आणविक फार्मूला | C12H22O4 |
आण्विक वजन | 230.3007 |
InChI | InChI=1/C12H22O4/c1-2-16-12(15)10-8-6-4-3-5-7-9-11(13)14/h2-10H2,1H3,(H,13,14) |
कैस रजिस्टी संख्या | 693-55-0 |
EINECS | 211-753-1 |
आणविक संरचना | |
घनत्व | 1.024g/cm3 |
उबलने का समय | 336°C at 760 mmHg |
अपवर्तक सूचकांक | 1.455 |
फ्लैश प्वाइंट | 119°C |
वाष्प का दबाव | 2.17E-05mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |