ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
637-39-8 Triethanolamine hydrochloride |
|
उत्पाद का नाम | Triethanolamine hydrochloride |
अंग्रेज | Triethanolamine hydrochloride;2,2,2-Nitrilotriethanol hydrochloride~Tris(2-hydroxyethyl)amine hydrochloride;triethanolamine hcl;tris(2-hydroxyethyl)ammonium chloride;2,2',2''-nitrilotriethanol hydrochloride (1:1) |
आणविक फार्मूला | C6H16ClNO3 |
आण्विक वजन | 185.6491 |
InChI | InChI=1/C6H15NO3.ClH/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;1H |
कैस रजिस्टी संख्या | 637-39-8 |
EINECS | 211-284-2 |
आणविक संरचना | |
गलनांक | 177-179℃ |
उबलने का समय | 335.4°C at 760 mmHg |
फ्लैश प्वाइंट | 185°C |
वाष्प का दबाव | 8.38E-06mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |