ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-32-6 Benzoyl bromide |
|
उत्पाद का नाम | Benzoyl bromide |
अंग्रेज | Benzoyl bromide; |
आणविक फार्मूला | C7H5BrO |
आण्विक वजन | 185.018 |
InChI | InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
कैस रजिस्टी संख्या | 618-32-6 |
EINECS | 210-544-2 |
आणविक संरचना | |
घनत्व | 1.572g/cm3 |
गलनांक | -24℃ |
उबलने का समय | 218.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.584 |
फ्लैश प्वाइंट | 89.7°C |
वाष्प का दबाव | 0.125mmHg at 25°C |
खतरा प्रतीक | C##Corrosive:; |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S25##Avoid contact with eyes.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |