ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
615-94-1 2,5-Dihydroxy-1,4-benzoquinone |
|
उत्पाद का नाम | 2,5-Dihydroxy-1,4-benzoquinone |
अंग्रेज | 2,5-Dihydroxy-1,4-benzoquinone;2,5-Dihydroxybenzoquinone;2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
आणविक फार्मूला | C6H4O4 |
आण्विक वजन | 140.0936 |
InChI | InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
कैस रजिस्टी संख्या | 615-94-1 |
EINECS | 210-454-3 |
आणविक संरचना | |
घनत्व | 1.843g/cm3 |
गलनांक | 220℃ |
उबलने का समय | 322.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.729 |
फ्लैश प्वाइंट | 162.9°C |
वाष्प का दबाव | 2.24E-05mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |