ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
BENZYL-2-NAPHTHYLETHER |
|
उत्पाद का नाम | BENZYL-2-NAPHTHYLETHER |
अंग्रेज | BENZYL-2-NAPHTHYLETHER;BETA-NAPHTHYLBENZYLETHER (BON);2-(phenylmethoxy)naphthalene;nbe;NIPAFAX BNE SENSLON-50;2-(benzyloxy)naphthalene;2-Benzyloxynaphthalene;2-(Phenylmethoxy)-Naphthalene |
आणविक फार्मूला | C17H14O |
आण्विक वजन | 234.2925 |
InChI | InChI=1/C17H14O/c1-2-6-14(7-3-1)13-18-17-11-10-15-8-4-5-9-16(15)12-17/h1-12H,13H2 |
कैस रजिस्टी संख्या | 613-62-7 |
EINECS | 405-490-3 |
आणविक संरचना | |
घनत्व | 1.125g/cm3 |
उबलने का समय | 388.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.642 |
फ्लैश प्वाइंट | 156.4°C |
वाष्प का दबाव | 7.02E-06mmHg at 25°C |
खतरे के कोड | R53##May cause long-term adverse effects in the aquatic environment.:; |
सुरक्षा विवरण | S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
MSDS |