ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-13-8 2-Aminoanthracene |
|
उत्पाद का नाम | 2-Aminoanthracene |
अंग्रेज | 2-Aminoanthracene;2-anthramine practical grade*crystalline;2-anthrylamine;2-Anthramine;2-Anthranamine;anthracen-2-amine;2-Anthracenamide; |
आणविक फार्मूला | C14H11N |
आण्विक वजन | 193.2438 |
InChI | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
कैस रजिस्टी संख्या | 613-13-8 |
EINECS | 210-330-9 |
आणविक संरचना | |
घनत्व | 1.208g/cm3 |
गलनांक | 238-241℃ |
उबलने का समय | 414.2°C at 760 mmHg |
अपवर्तक सूचकांक | 1.765 |
फ्लैश प्वाइंट | 229°C |
वाष्प का दबाव | 4.52E-07mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R33##Danger of cummulative effects.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |