ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
612-28-2 N-Methyl-2-nitroaniline |
|
उत्पाद का नाम | N-Methyl-2-nitroaniline |
अंग्रेज | N-Methyl-2-nitroaniline;Benzenamine, N-methyl-2-nitro-;2-Nitro-N-methylaniline;4-12-00-01564 (Beilstein Handbook Reference);Aniline, N-methyl-o-nitro-;BRN 2209110;N-Methyl-2-nitrobenzenamine;N-Methyl-o-nitroaniline;NSC 86672;o-(Methylamino)nitrobenzene;o-Nitro-N-methylaniline |
आणविक फार्मूला | C7H8N2O2 |
आण्विक वजन | 152.1506 |
InChI | InChI=1/C7H8N2O2/c1-8-6-4-2-3-5-7(6)9(10)11/h2-5,8H,1H3 |
कैस रजिस्टी संख्या | 612-28-2 |
EINECS | 210-303-1 |
आणविक संरचना | |
घनत्व | 1.26g/cm3 |
गलनांक | 33-37℃ |
उबलने का समय | 277.9°C at 760 mmHg |
अपवर्तक सूचकांक | 1.619 |
फ्लैश प्वाइंट | 121.9°C |
वाष्प का दबाव | 0.0044mmHg at 25°C |
खतरा प्रतीक | T##Toxic:; |
खतरे के कोड | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
सुरक्षा विवरण | S28A##After contact with skin, wash immediately with plenty of water.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |