ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Nitrobenzyl chloride |
|
उत्पाद का नाम | 2-Nitrobenzyl chloride |
अंग्रेज | 2-Nitrobenzyl chloride;alpha-Chloro-2-nitrotoluene;a-Chloro-2-nitrotoluene);1-chloro-2-methyl-3-nitrobenzene;1-(chloromethyl)-2-nitrobenzene |
आणविक फार्मूला | C7H6ClNO2 |
आण्विक वजन | 171.581 |
InChI | InChI=1/C7H6ClNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
कैस रजिस्टी संख्या | 612-23-7 |
EINECS | 210-300-5 |
आणविक संरचना | |
घनत्व | 1.33g/cm3 |
गलनांक | 46-50℃ |
उबलने का समय | 269°C at 760 mmHg |
अपवर्तक सूचकांक | 1.574 |
फ्लैश प्वाइंट | 112.7°C |
वाष्प का दबाव | 0.0123mmHg at 25°C |
खतरा प्रतीक | C##Corrosive:; |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |