ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-16-2 2-Dimethylaminobenzoic acid |
|
उत्पाद का नाम | 2-Dimethylaminobenzoic acid |
अंग्रेज | 2-Dimethylaminobenzoic acid;Benzoic acid, 2-(dimethylamino)-;2-(Dimethylamino)benzoic acid;AI3-05925;N,N-Dimethylanthranilic acid;NSC 45790;Anthranilic acid, N,N-dimethyl- (8CI);2-(dimethylamino)benzoate |
आणविक फार्मूला | C9H10NO2 |
आण्विक वजन | 164.1817 |
InChI | InChI=1/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12)/p-1 |
कैस रजिस्टी संख्या | 610-16-2 |
EINECS | 210-209-0 |
आणविक संरचना | |
गलनांक | 71-72℃ |
उबलने का समय | 288.5°C at 760 mmHg |
फ्लैश प्वाइंट | 128.3°C |
वाष्प का दबाव | 0.00108mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |