ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
605-62-9 4-Nitro-1-Naphthol |
|
उत्पाद का नाम | 4-Nitro-1-Naphthol |
अंग्रेज | 4-Nitro-1-Naphthol;4-nitronaphthalen-1-ol |
आणविक फार्मूला | C10H7NO3 |
आण्विक वजन | 189.1675 |
InChI | InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
कैस रजिस्टी संख्या | 605-62-9 |
आणविक संरचना | ![]() |
घनत्व | 1.413g/cm3 |
उबलने का समय | 398.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.714 |
फ्लैश प्वाइंट | 179.8°C |
वाष्प का दबाव | 6.25E-07mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |