ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-Nitroacenaphthene |
|
उत्पाद का नाम | 5-Nitroacenaphthene |
अंग्रेज | 5-Nitroacenaphthene;1,2-Dihydro-5-nitro-acenaphthylene;4-05-00-01840 (Beilstein Handbook Reference);5-Nan;5-Nitroacenaphthylene;5-Nitroacenapthene;5-Nitronaphthalene;5-Nitronaphthalene ethylene;Acenaphthene, 5-nitro-;Acenaphthylene, 1,2-dihydro-5-nitro-;BRN 1876864;CCRIS 438;HSDB 4092;NCI-C01967;NSC 1312;NSC 22421;1,2-Dihydro-5-nitroacenaphthylene;5-nitro-1,2-dihydroacenaphthylene;Nitroacenaphthene;1,2-dihydro-5-nitro-acenaphthylen |
आणविक फार्मूला | C12H7NO2 |
आण्विक वजन | 197.1895 |
InChI | InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
कैस रजिस्टी संख्या | 602-87-9 |
EINECS | 210-025-0 |
आणविक संरचना | |
घनत्व | 1.408g/cm3 |
गलनांक | 101-102℃ |
उबलने का समय | 381.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.763 |
फ्लैश प्वाइंट | 196.7°C |
वाष्प का दबाव | 1.1E-05mmHg at 25°C |
खतरे के कोड | R45##May cause cancer.:; |
सुरक्षा विवरण | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
MSDS |