ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
9-Phenylanthracene |
|
उत्पाद का नाम | 9-Phenylanthracene |
अंग्रेज | 9-Phenylanthracene;Phenylanthracene;anthracene,9-phenyl-;9-phenylantracene |
आणविक फार्मूला | C20H14 |
आण्विक वजन | 254.3252 |
InChI | InChI=1/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H |
कैस रजिस्टी संख्या | 602-55-1 |
EINECS | 210-019-8 |
आणविक संरचना | |
घनत्व | 1.14g/cm3 |
गलनांक | 149-153℃ |
उबलने का समय | 417°C at 760 mmHg |
अपवर्तक सूचकांक | 1.703 |
फ्लैश प्वाइंट | 192.1°C |
वाष्प का दबाव | 8.86E-07mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |