ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 60-93-5 quinine dihydrochloride | |
| उत्पाद का नाम | quinine dihydrochloride | 
| अंग्रेज | quinine dihydrochloride;Quinine Dihydochloride;(8alpha,9R)-6'-methoxycinchonan-9-ol dihydrochloride | 
| आणविक फार्मूला | C20H26Cl2N2O2 | 
| आण्विक वजन | 397.3386 | 
| InChI | InChI=1/C20H24N2O2.2ClH/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2*1H/t13-,14-,19-,20+;;/m0../s1 | 
| कैस रजिस्टी संख्या | 60-93-5 | 
| EINECS | 200-493-4 | 
| आणविक संरचना |  | 
| उबलने का समय | 495.9°C at 760 mmHg | 
| फ्लैश प्वाइंट | 253.7°C | 
| वाष्प का दबाव | 1.19E-10mmHg at 25°C | 
| खतरे के कोड | R22##Harmful if swallowed.||R42/43##May cause sensitization by inhalation and skin contact.:; | 
| सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |