Chemindex > 59-85-8
IN ▼
4-(chloromercurio)benzoic acid |
|
| उत्पाद का नाम | 4-(chloromercurio)benzoic acid |
| अंग्रेज | 4-(chloromercurio)benzoic acid;4-chloromercuriobenzoic acid;4-Chloromercuribenzoic acid;(4-carboxyphenyl)(chloro)mercury;(4-carboxyphenyl)mercury(1+) chloride |
| आणविक फार्मूला | C7H5ClHgO2 |
| आण्विक वजन | 357.1564 |
| InChI | InChI=1/C7H5O2.ClH.Hg/c8-7(9)6-4-2-1-3-5-6;;/h2-5H,(H,8,9);1H;/q;;+1/p-1/rC7H5HgO2.ClH/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10);1H/q+1;/p-1 |
| कैस रजिस्टी संख्या | 59-85-8 |
| EINECS | 200-442-6 |
| आणविक संरचना |  |
| गलनांक | 300℃ |
| खतरे के कोड | R26/27/28##Very toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
| सुरक्षा विवरण | S13##Keep away from food, drink and animal feeding stuffs.||S28##After contact with skin, wash immediately with plenty of ...||S36##Wear suitable protective clothing.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- यदि आप चीन से रसायन प्राप्त करने की योजना बना रहे हैं, तो बस जाएं केमनेट मॉल, हम आपके लिए चीन के निर्माताओं से नवीनतम और प्रतिस्पर्धी मूल्य प्राप्त करेंगे।कृपया ChemNet Mall पर जाएं
रासायनिक सीएएस डेटाबेस सेवा ChemIndex.com द् 