ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-Nitro-2-furonitrile |
|
उत्पाद का नाम | 5-Nitro-2-furonitrile |
अंग्रेज | 5-Nitro-2-furonitrile;5-Nitro-2-furancarbonitrile;5-nitrofuran-2-carbonitrile |
आणविक फार्मूला | C5H2N2O3 |
आण्विक वजन | 138.081 |
InChI | InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
कैस रजिस्टी संख्या | 59-82-5 |
आणविक संरचना | |
घनत्व | 1.46g/cm3 |
उबलने का समय | 234.7°C at 760 mmHg |
अपवर्तक सूचकांक | 1.544 |
फ्लैश प्वाइंट | 95.7°C |
वाष्प का दबाव | 0.0522mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |