ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58414-52-1 Methyl thiophene-3-acetate |
|
उत्पाद का नाम | Methyl thiophene-3-acetate |
अंग्रेज | Methyl thiophene-3-acetate;Methyl 3-thienylacetate~Thiophene-3-acetic acid methyl ester;3-Thiopheneacetic acid methyl ester;methyl thiophen-3-ylacetate |
आणविक फार्मूला | C7H8O2S |
आण्विक वजन | 156.2022 |
InChI | InChI=1/C7H8O2S/c1-9-7(8)4-6-2-3-10-5-6/h2-3,5H,4H2,1H3 |
कैस रजिस्टी संख्या | 58414-52-1 |
EINECS | 261-242-2 |
आणविक संरचना | ![]() |
घनत्व | 1.185g/cm3 |
उबलने का समय | 210.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.528 |
फ्लैश प्वाइंट | 81.1°C |
वाष्प का दबाव | 0.193mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |