Chemindex > 57878-93-0
IN ▼
57878-93-0 2-chloro-4-methylphenyl isothiocyanate |
|
| उत्पाद का नाम | 2-chloro-4-methylphenyl isothiocyanate |
| अंग्रेज | 2-chloro-4-methylphenyl isothiocyanate;2-Chloro-4-methylphenyl isothiocyanate;2-chloro-1-isothiocyanato-4-methylbenzene |
| आणविक फार्मूला | C8H6ClNS |
| आण्विक वजन | 183.6579 |
| InChI | InChI=1/C8H6ClNS/c1-6-2-3-8(10-5-11)7(9)4-6/h2-4H,1H3 |
| कैस रजिस्टी संख्या | 57878-93-0 |
| आणविक संरचना |  |
| घनत्व | 1.18g/cm3 |
| उबलने का समय | 286.8°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.583 |
| फ्लैश प्वाइंट | 127.3°C |
| वाष्प का दबाव | 0.00444mmHg at 25°C |
| खतरा प्रतीक |  Xn##Harmful:; |
| खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- यदि आप चीन से रसायन प्राप्त करने की योजना बना रहे हैं, तो बस जाएं केमनेट मॉल, हम आपके लिए चीन के निर्माताओं से नवीनतम और प्रतिस्पर्धी मूल्य प्राप्त करेंगे।कृपया ChemNet Mall पर जाएं
57878-93-0 (0) के लिए आपूर्तिकर्ता:
रासायनिक सीएएस डेटाबेस सेवा ChemIndex.com द् 