ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56-53-1 Diethylstilbestrol |
|
उत्पाद का नाम | Diethylstilbestrol |
अंग्रेज | Diethylstilbestrol;Stilboestrol;a,a-Diethyl-4,4-Stilbenediol Carc.;Atovaquone;4,4'-(3E)-hex-3-ene-3,4-diyldiphenol;4,4'-(3Z)-hex-3-ene-3,4-diyldiphenol;diethylstilbestrol, mixture of cis and trans;Diethylstilbestrol,mixture of cis and trans;Diethylstilbestrol BP |
आणविक फार्मूला | C18H20O2 |
आण्विक वजन | 268.3502 |
InChI | InChI=1/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17- |
कैस रजिस्टी संख्या | 56-53-1;6898-97-1 |
EINECS | 200-278-5 |
आणविक संरचना | ![]() |
घनत्व | 1.107g/cm3 |
गलनांक | 169-175℃ |
उबलने का समय | 407.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.603 |
फ्लैश प्वाइंट | 187°C |
पानी की विलेयता | PRACTICALLY INSOLUBLE |
वाष्प का दबाव | 3.29E-07mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R40||R45||R61||R36/37/38||R51/53:; |
सुरक्षा विवरण | S36/37/39||S45||S53||S60||S61:; |
MSDS |