ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5524-05-0 (+)-Dihydrocarvone |
|
उत्पाद का नाम | (+)-Dihydrocarvone |
अंग्रेज | (+)-Dihydrocarvone;(+)-Dihydrocarvone, mixture of isomers;p-Menth-8(9)-en-2-one;8-p-Menthen-2-one;(2R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone;(2S,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone |
आणविक फार्मूला | C10H16O |
आण्विक वजन | 152.2334 |
InChI | InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3/t8-,9+/m0/s1 |
कैस रजिस्टी संख्या | 5524-05-0 |
EINECS | 226-872-4 |
आणविक संरचना | |
घनत्व | 0.903g/cm3 |
उबलने का समय | 221.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.457 |
फ्लैश प्वाइंट | 82.6°C |
वाष्प का दबाव | 0.107mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |