ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54-77-3 1,1-डाइमिथाइल-4-फेनिलपाइपरजिनियम आयोडाइड |
|
उत्पाद का नाम | 1,1-डाइमिथाइल-4-फेनिलपाइपरजिनियम आयोडाइड |
समानार्थी | ; 1,1-डाइमिथाइल-4-फेनिलपाइपरज़िन-1-ium आयोडाइड; |
अंग्रेज | 1,1-Dimethyl-4-phenylpiperazinium iodide;1,1-dimethyl-4-phenylpiperazin-1-ium iodide |
आणविक फार्मूला | C12H19IN2 |
आण्विक वजन | 318.1971 |
InChI | InChI=1/C12H19N2.HI/c1-14(2)10-8-13(9-11-14)12-6-4-3-5-7-12;/h3-7H,8-11H2,1-2H3;1H/q+1;/p-1 |
कैस रजिस्टी संख्या | 54-77-3 |
EINECS | 200-213-0 |
आणविक संरचना | |
गलनांक | 234-238℃ |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |