ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
tetraiodoethylene |
|
उत्पाद का नाम | tetraiodoethylene |
अंग्रेज | tetraiodoethylene;diiodoform;tetraiodoethene |
आणविक फार्मूला | C2I4 |
आण्विक वजन | 531.6393 |
InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
कैस रजिस्टी संख्या | 513-92-8 |
EINECS | 208-176-2 |
आणविक संरचना | |
घनत्व | 4.087g/cm3 |
गलनांक | 191-193℃ |
उबलने का समय | 288.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.952 |
फ्लैश प्वाइंट | 139.9°C |
वाष्प का दबाव | 0.00409mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |