ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51-18-3 Triethylenemelamine |
|
उत्पाद का नाम | Triethylenemelamine |
अंग्रेज | Triethylenemelamine;Tretamine;2,4,6-tri(aziridin-1-yl)-1,3,5-triazine;2,4,6-Tris(1-aziridinyl)-s-triazine;TEM;2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
आणविक फार्मूला | C9H12N6 |
आण्विक वजन | 204.2318 |
InChI | InChI=1/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
कैस रजिस्टी संख्या | 51-18-3 |
EINECS | 200-083-5 |
आणविक संरचना | |
घनत्व | 1.617g/cm3 |
गलनांक | 160℃ |
उबलने का समय | 430.2°C at 760 mmHg |
अपवर्तक सूचकांक | 1.789 |
फ्लैश प्वाइंट | 214°C |
वाष्प का दबाव | 1.32E-07mmHg at 25°C |
खतरा प्रतीक | T+##Very toxic:; |
खतरे के कोड | R28##Very toxic if swallowed.||R40##Possible risks of irreversible effects.:; |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |