ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50529-33-4 3-chloro-4-(fluorophenyl)isocyanate |
|
उत्पाद का नाम | 3-chloro-4-(fluorophenyl)isocyanate |
अंग्रेज | 3-chloro-4-(fluorophenyl)isocyanate;3-Chloro-4-fluorophenyl isocyanate;2-chloro-1-fluoro-4-isocyanatobenzene |
आणविक फार्मूला | C7H3ClFNO |
आण्विक वजन | 171.5562 |
InChI | InChI=1/C7H3ClFNO/c8-6-3-5(10-4-11)1-2-7(6)9/h1-3H |
कैस रजिस्टी संख्या | 50529-33-4 |
आणविक संरचना | |
घनत्व | 1.31g/cm3 |
उबलने का समय | 228.7°C at 760 mmHg |
अपवर्तक सूचकांक | 1.533 |
फ्लैश प्वाइंट | 92.1°C |
वाष्प का दबाव | 0.0723mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R23/25##Toxic by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.||R42##May cause sensitization by inhalation.:; |
सुरक्षा विवरण | S23##Do not inhale gas/fumes/vapour/spray.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |