ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
502-50-1 4-Ketopimelic acid |
|
उत्पाद का नाम | 4-Ketopimelic acid |
अंग्रेज | 4-Ketopimelic acid;4-Oxopimelic acid;4-oxoheptanedioic acid;4-oxoheptanedioate |
आणविक फार्मूला | C7H8O5 |
आण्विक वजन | 172.1365 |
InChI | InChI=1/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
कैस रजिस्टी संख्या | 502-50-1 |
EINECS | 207-941-8 |
आणविक संरचना | |
गलनांक | 142-144℃ |
उबलने का समय | 420.4°C at 760 mmHg |
फ्लैश प्वाइंट | 222.2°C |
वाष्प का दबाव | 3.03E-08mmHg at 25°C |
खतरा प्रतीक | Xi##Irritant:; |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |