ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Fluoro-N-methylaniline |
|
उत्पाद का नाम | 4-Fluoro-N-methylaniline |
अंग्रेज | 4-Fluoro-N-methylaniline;4-Fluoro-N-toluidine |
आणविक फार्मूला | C7H8FN |
आण्विक वजन | 125.1435 |
InChI | InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
कैस रजिस्टी संख्या | 459-59-6 |
EINECS | 207-294-1 |
आणविक संरचना | |
घनत्व | 1.106g/cm3 |
उबलने का समय | 181.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.546 |
फ्लैश प्वाइंट | 63.5°C |
वाष्प का दबाव | 0.853mmHg at 25°C |
खतरा प्रतीक | Xi##Irritant:; |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |