ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-47-2 1,4-ethylfluorobenzene |
|
उत्पाद का नाम | 1,4-ethylfluorobenzene |
अंग्रेज | 1,4-ethylfluorobenzene;1-Ethyl-4-fluorobenzene;benzene, 1-ethyl-4-fluoro-;Ethyl-4-fluorobenzene |
आणविक फार्मूला | C8H9F |
आण्विक वजन | 124.1555 |
InChI | InChI=1/C8H9F/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
कैस रजिस्टी संख्या | 459-47-2 |
आणविक संरचना | |
घनत्व | 0.981g/cm3 |
उबलने का समय | 141.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.477 |
फ्लैश प्वाइंट | 28.9°C |
वाष्प का दबाव | 7.26mmHg at 25°C |
खतरे के कोड | R10##Flammable.:; |
सुरक्षा विवरण | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |