Chemindex > 459-05-2
IN ▼
459-05-2 1-(4-fluorophenyl)-2-thiourea |
|
| उत्पाद का नाम | 1-(4-fluorophenyl)-2-thiourea |
| अंग्रेज | 1-(4-fluorophenyl)-2-thiourea;4-Fluorophenylthiourea;1-(4-fluorophenyl)thiourea |
| आणविक फार्मूला | C7H7FN2S |
| आण्विक वजन | 170.2073 |
| InChI | InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| कैस रजिस्टी संख्या | 459-05-2 |
| आणविक संरचना |  |
| घनत्व | 1.397g/cm3 |
| गलनांक | 164℃ |
| उबलने का समय | 264.2°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.692 |
| फ्लैश प्वाइंट | 113.6°C |
| वाष्प का दबाव | 0.00987mmHg at 25°C |
| खतरे के कोड | R25##Toxic if swallowed.:; |
| सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- यदि आप चीन से रसायन प्राप्त करने की योजना बना रहे हैं, तो बस जाएं केमनेट मॉल, हम आपके लिए चीन के निर्माताओं से नवीनतम और प्रतिस्पर्धी मूल्य प्राप्त करेंगे।कृपया ChemNet Mall पर जाएं
रासायनिक सीएएस डेटाबेस सेवा ChemIndex.com द् 