ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-fluoropropiophenone |
|
उत्पाद का नाम | 3-fluoropropiophenone |
अंग्रेज | 3-fluoropropiophenone;3'-FLUOROPROPIOPHENONE;1-(3-fluorophenyl)propan-1-one |
आणविक फार्मूला | C9H9FO |
आण्विक वजन | 152.1656 |
InChI | InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
कैस रजिस्टी संख्या | 455-67-4 |
आणविक संरचना | |
घनत्व | 1.074g/cm3 |
उबलने का समय | 209.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.489 |
फ्लैश प्वाइंट | 79.8°C |
वाष्प का दबाव | 0.199mmHg at 25°C |
खतरे के कोड | R36/38##Irritating to eyes and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |