Chemindex > 4521-31-7
IN ▼
4521-31-7 2-Mercaptobenzyl alcohol |
|
| उत्पाद का नाम | 2-Mercaptobenzyl alcohol |
| अंग्रेज | 2-Mercaptobenzyl alcohol;2-(Hydroxymethyl)thiophenol;O-Mercaptobenzyl alcohol;(2-Sulfanylphenyl)methanol;2- Mercaptobenzyl alcohol, tech. ;2-(hydroxymethyl)benzenethiolate |
| आणविक फार्मूला | C7H7OS |
| आण्विक वजन | 139.1954 |
| InChI | InChI=1/C7H8OS/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2/p-1 |
| कैस रजिस्टी संख्या | 4521-31-7 |
| आणविक संरचना |  |
| गलनांक | 31-32℃ |
| उबलने का समय | 276.5°C at 760 mmHg |
| फ्लैश प्वाइंट | 121°C |
| वाष्प का दबाव | 0.00231mmHg at 25°C |
| खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- यदि आप चीन से रसायन प्राप्त करने की योजना बना रहे हैं, तो बस जाएं केमनेट मॉल, हम आपके लिए चीन के निर्माताओं से नवीनतम और प्रतिस्पर्धी मूल्य प्राप्त करेंगे।कृपया ChemNet Mall पर जाएं
4521-31-7 (0) के लिए आपूर्तिकर्ता:
रासायनिक सीएएस डेटाबेस सेवा ChemIndex.com द् 