ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Desyl chloride |
|
उत्पाद का नाम | Desyl chloride |
अंग्रेज | Desyl chloride;alpha-Chloro-alpha-phenylacetophenone;alpha-chlorodeoxybenzoin;2-chloro-1,2-diphenylethanone;(2R)-2-chloro-1,2-diphenylethanone;(2S)-2-chloro-1,2-diphenylethanone |
आणविक फार्मूला | C14H11ClO |
आण्विक वजन | 230.6895 |
InChI | InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
कैस रजिस्टी संख्या | 447-31-4 |
EINECS | 207-181-7 |
आणविक संरचना | |
घनत्व | 1.19g/cm3 |
गलनांक | 65-69℃ |
उबलने का समय | 345.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.592 |
फ्लैश प्वाइंट | 190.4°C |
वाष्प का दबाव | 6.14E-05mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R20/21##Harmful by inhalation and in contact with skin.||R37##Irritating to respiratory system.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S24##Avoid contact with skin.:; |
MSDS |