ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|
उत्पाद का नाम | 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
अंग्रेज | 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;(6S)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;(6R)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
आणविक फार्मूला | C10H12N2S |
आण्विक वजन | 192.2807 |
InChI | InChI=1/C10H12N2S/c1-6-2-3-7-8(5-11)10(12)13-9(7)4-6/h6H,2-4,12H2,1H3/t6-/m1/s1 |
कैस रजिस्टी संख्या | 42225-04-7 |
आणविक संरचना | |
घनत्व | 1.22g/cm3 |
गलनांक | 147℃ |
उबलने का समय | 392.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.607 |
फ्लैश प्वाइंट | 191.4°C |
वाष्प का दबाव | 2.23E-06mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |